C12H20BrN — CID 121012189
1-[(3E,5Z)-5-bromohepta-3,5-dien-2-yl]piperidine (PubChem CID 121012189) has the molecular formula C12H20BrN and a molecular weight of 258.20 g/mol. Its IUPAC name is 1-[(3E,5Z)-5-bromohepta-3,5-dien-2-yl]piperidine.
| Compound Name | 1-[(3E,5Z)-5-bromohepta-3,5-dien-2-yl]piperidine |
|---|---|
| PubChem CID | 121012189 |
| Molecular Formula | C12H20BrN |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 1-[(3E,5Z)-5-bromohepta-3,5-dien-2-yl]piperidine |
| SMILES | C/C=C(Br)/C=C/C(C)N1CCCCC1 |
| InChI | InChI=1S/C12H20BrN/c1-3-12(13)8-7-11(2)14-9-5-4-6-10-14/h3,7-8,11H,4-6,9-10H2,1-2H3/b8-7+,12-3- |
| InChIKey | UPTMLLVUDTUHRZ-LUDCFUFLSA-N |
| XLogP | 3.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|