C9H15NO2 — CID 177230403
(E,4R)-4-pyrrolidin-1-ylpent-2-enoic acid (PubChem CID 177230403) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (E,4R)-4-pyrrolidin-1-ylpent-2-enoic acid.
| Compound Name | (E,4R)-4-pyrrolidin-1-ylpent-2-enoic acid |
|---|---|
| PubChem CID | 177230403 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (E,4R)-4-pyrrolidin-1-ylpent-2-enoic acid |
| SMILES | C[C@H](/C=C/C(=O)O)N1CCCC1 |
| InChI | InChI=1S/C9H15NO2/c1-8(4-5-9(11)12)10-6-2-3-7-10/h4-5,8H,2-3,6-7H2,1H3,(H,11,12)/b5-4+/t8-/m1/s1 |
| InChIKey | RXSNUGVKJQELMG-WTSVBCDHSA-N |
| XLogP | 1.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|