C11H20 — CID 14899752
(3E)-2,5-dimethylnona-1,3-diene (PubChem CID 14899752) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (3E)-2,5-dimethylnona-1,3-diene.
| Compound Name | (3E)-2,5-dimethylnona-1,3-diene |
|---|---|
| PubChem CID | 14899752 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (3E)-2,5-dimethylnona-1,3-diene |
| SMILES | C=C(C)/C=C/C(C)CCCC |
| InChI | InChI=1S/C11H20/c1-5-6-7-11(4)9-8-10(2)3/h8-9,11H,2,5-7H2,1,3-4H3/b9-8+ |
| InChIKey | OMSORCARHLCDTO-CMDGGOBGSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|