C16H30N2 — CID 171553943
(4Z)-2-N-heptan-3-yl-3-N,6-dimethylhepta-1,4,6-triene-2,3-diamine (PubChem CID 171553943) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is (4Z)-2-N-heptan-3-yl-3-N,6-dimethylhepta-1,4,6-triene-2,3-diamine.
| Compound Name | (4Z)-2-N-heptan-3-yl-3-N,6-dimethylhepta-1,4,6-triene-2,3-diamine |
|---|---|
| PubChem CID | 171553943 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | (4Z)-2-N-heptan-3-yl-3-N,6-dimethylhepta-1,4,6-triene-2,3-diamine |
| SMILES | C=C(C)/C=C\C(NC)C(=C)NC(CC)CCCC |
| InChI | InChI=1S/C16H30N2/c1-7-9-10-15(8-2)18-14(5)16(17-6)12-11-13(3)4/h11-12,15-18H,3,5,7-10H2,1-2,4,6H3/b12-11- |
| InChIKey | ZVJXLHWDJCXTPP-QXMHVHEDSA-N |
| XLogP | 3.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|