C12H23N — CID 142109813
N-(4-methylpenta-1,4-dien-2-yl)hexan-2-amine (PubChem CID 142109813) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N-(4-methylpenta-1,4-dien-2-yl)hexan-2-amine.
| Compound Name | N-(4-methylpenta-1,4-dien-2-yl)hexan-2-amine |
|---|---|
| PubChem CID | 142109813 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-(4-methylpenta-1,4-dien-2-yl)hexan-2-amine |
| SMILES | C=C(C)CC(=C)NC(C)CCCC |
| InChI | InChI=1S/C12H23N/c1-6-7-8-11(4)13-12(5)9-10(2)3/h11,13H,2,5-9H2,1,3-4H3 |
| InChIKey | OGBCRAUXNKPHDV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|