About N-hexan-2-ylacetamide;methane
N-hexan-2-ylacetamide;methane (PubChem CID 161054772) has the molecular formula C11H29NO
and a molecular weight of 191.36 g/mol. Its IUPAC name is N-hexan-2-ylacetamide;methane.
Molecular Properties
| Compound Name | N-hexan-2-ylacetamide;methane |
| PubChem CID | 161054772 |
| Molecular Formula | C11H29NO |
| Molecular Weight | 191.36 g/mol |
| Exact Mass | 191.22 |
| IUPAC Name | N-hexan-2-ylacetamide;methane |
| SMILES | C.C.C.CCCCC(C)NC(C)=O |
| InChI | InChI=1S/C8H17NO.3CH4/c1-4-5-6-7(2)9-8(3)10;;;/h7H,4-6H2,1-3H3,(H,9,10);3*1H4 |
| InChIKey | UCPHJHHGCGEQRO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-hexan-2-ylacetamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexan-2-ylacetamide;methane?
The IUPAC name of N-hexan-2-ylacetamide;methane (CID 161054772) is N-hexan-2-ylacetamide;methane.
What is the SMILES notation for N-hexan-2-ylacetamide;methane?
The canonical SMILES for N-hexan-2-ylacetamide;methane is C.C.C.CCCCC(C)NC(C)=O.
What is the InChIKey of N-hexan-2-ylacetamide;methane?
The InChIKey is UCPHJHHGCGEQRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.3CH4/c1-4-5-6-7(2)9-8(3)10;;;/h7H,4-6H2,1-3H3,(H,9,10);3*1H4.
What are the key properties of N-hexan-2-ylacetamide;methane?
N-hexan-2-ylacetamide;methane has a molecular weight of 191.36 g/mol, XLogP of 3.61, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexan-2-ylacetamide;methane is sourced from PubChem (CID 161054772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).