C26H48 — CID 123243891
2,5,6,10,11,12-hexamethyl-7-(2-methylprop-2-enyl)hexadeca-1,3-diene (PubChem CID 123243891) has the molecular formula C26H48 and a molecular weight of 360.67 g/mol. Its IUPAC name is 2,5,6,10,11,12-hexamethyl-7-(2-methylprop-2-enyl)hexadeca-1,3-diene.
| Compound Name | 2,5,6,10,11,12-hexamethyl-7-(2-methylprop-2-enyl)hexadeca-1,3-diene |
|---|---|
| PubChem CID | 123243891 |
| Molecular Formula | C26H48 |
| Molecular Weight | 360.67 g/mol |
| Exact Mass | 360.38 |
| IUPAC Name | 2,5,6,10,11,12-hexamethyl-7-(2-methylprop-2-enyl)hexadeca-1,3-diene |
| SMILES | C=C(C)C=CC(C)C(C)C(CCC(C)C(C)C(C)CCCC)CC(=C)C |
| InChI | InChI=1S/C26H48/c1-11-12-13-21(6)24(9)22(7)16-17-26(18-20(4)5)25(10)23(8)15-14-19(2)3/h14-15,21-26H,2,4,11-13,16-18H2,1,3,5-10H3 |
| InChIKey | RACUUQIJPDFJAX-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.67 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|