C27H56 — CID 143901355
ethane;3-methylheptane;(3Z)-2,6,9-trimethyl-5-methylideneundeca-1,3-diene (PubChem CID 143901355) has the molecular formula C27H56 and a molecular weight of 380.75 g/mol. Its IUPAC name is ethane;3-methylheptane;(3Z)-2,6,9-trimethyl-5-methylideneundeca-1,3-diene.
| Compound Name | ethane;3-methylheptane;(3Z)-2,6,9-trimethyl-5-methylideneundeca-1,3-diene |
|---|---|
| PubChem CID | 143901355 |
| Molecular Formula | C27H56 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.44 |
| IUPAC Name | ethane;3-methylheptane;(3Z)-2,6,9-trimethyl-5-methylideneundeca-1,3-diene |
| SMILES | C=C(C)/C=C\C(=C)C(C)CCC(C)CC.CC.CC.CCCCC(C)CC |
| InChI | InChI=1S/C15H26.C8H18.2C2H6/c1-7-13(4)9-11-15(6)14(5)10-8-12(2)3;1-4-6-7-8(3)5-2;2*1-2/h8,10,13,15H,2,5,7,9,11H2,1,3-4,6H3;8H,4-7H2,1-3H3;2*1-2H3/b10-8-;;; |
| InChIKey | ILQDZRNFTJJQLF-MWHRLNGWSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|