C12H20O — CID 145192071
(3Z)-8-methoxy-2,6-dimethyl-5-methylideneocta-1,3-diene (PubChem CID 145192071) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (3Z)-8-methoxy-2,6-dimethyl-5-methylideneocta-1,3-diene.
| Compound Name | (3Z)-8-methoxy-2,6-dimethyl-5-methylideneocta-1,3-diene |
|---|---|
| PubChem CID | 145192071 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (3Z)-8-methoxy-2,6-dimethyl-5-methylideneocta-1,3-diene |
| SMILES | C=C(C)/C=C\C(=C)C(C)CCOC |
| InChI | InChI=1S/C12H20O/c1-10(2)6-7-11(3)12(4)8-9-13-5/h6-7,12H,1,3,8-9H2,2,4-5H3/b7-6- |
| InChIKey | QSAIULYETHUDHK-SREVYHEPSA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|