C17H32 — CID 166116853
(Z)-2,7-dimethyl-3,6-dimethylidenedec-4-ene;propane (PubChem CID 166116853) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is (Z)-2,7-dimethyl-3,6-dimethylidenedec-4-ene;propane.
| Compound Name | (Z)-2,7-dimethyl-3,6-dimethylidenedec-4-ene;propane |
|---|---|
| PubChem CID | 166116853 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | (Z)-2,7-dimethyl-3,6-dimethylidenedec-4-ene;propane |
| SMILES | C=C(/C=C\C(=C)C(C)CCC)C(C)C.CCC |
| InChI | InChI=1S/C14H24.C3H8/c1-7-8-13(5)14(6)10-9-12(4)11(2)3;1-3-2/h9-11,13H,4,6-8H2,1-3,5H3;3H2,1-2H3/b10-9-; |
| InChIKey | JLIROFDXGHTLAE-KVVVOXFISA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|