C12H19I — CID 143788216
(2E,5Z)-8-methyl-4,7-dimethylidenenona-2,5-diene;hydroiodide (PubChem CID 143788216) has the molecular formula C12H19I and a molecular weight of 290.19 g/mol. Its IUPAC name is (2E,5Z)-8-methyl-4,7-dimethylidenenona-2,5-diene;hydroiodide.
| Compound Name | (2E,5Z)-8-methyl-4,7-dimethylidenenona-2,5-diene;hydroiodide |
|---|---|
| PubChem CID | 143788216 |
| Molecular Formula | C12H19I |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (2E,5Z)-8-methyl-4,7-dimethylidenenona-2,5-diene;hydroiodide |
| SMILES | C=C(/C=C\C(=C)C(C)C)/C=C/C.I |
| InChI | InChI=1S/C12H18.HI/c1-6-7-11(4)8-9-12(5)10(2)3;/h6-10H,4-5H2,1-3H3;1H/b7-6+,9-8-; |
| InChIKey | WPPOSJOENUJISK-CUOMSEFISA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|