C17H31N — CID 166146875
(2Z,5Z)-N,8-dimethyl-7-methylidene-3-propan-2-ylnona-2,5-dien-4-imine;ethane (PubChem CID 166146875) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is (2Z,5Z)-N,8-dimethyl-7-methylidene-3-propan-2-ylnona-2,5-dien-4-imine;ethane.
| Compound Name | (2Z,5Z)-N,8-dimethyl-7-methylidene-3-propan-2-ylnona-2,5-dien-4-imine;ethane |
|---|---|
| PubChem CID | 166146875 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | (2Z,5Z)-N,8-dimethyl-7-methylidene-3-propan-2-ylnona-2,5-dien-4-imine;ethane |
| SMILES | C=C(/C=C\C(=N\C)\C(=C/C)C(C)C)C(C)C.CC |
| InChI | InChI=1S/C15H25N.C2H6/c1-8-14(12(4)5)15(16-7)10-9-13(6)11(2)3;1-2/h8-12H,6H2,1-5,7H3;1-2H3/b10-9-,14-8-,16-15-; |
| InChIKey | ZNWQMRHGZWUXBS-UDCHTFNUSA-N |
| XLogP | 5.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|