C11H17N — CID 144536498
(3E,5Z)-8-methyl-7-methylidenenona-1,3,5-trien-4-amine (PubChem CID 144536498) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (3E,5Z)-8-methyl-7-methylidenenona-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-8-methyl-7-methylidenenona-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 144536498 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (3E,5Z)-8-methyl-7-methylidenenona-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(N)\C=C/C(=C)C(C)C |
| InChI | InChI=1S/C11H17N/c1-5-6-11(12)8-7-10(4)9(2)3/h5-9H,1,4,12H2,2-3H3/b8-7-,11-6+ |
| InChIKey | ARXPBVSILHNNAW-YKFSIMETSA-N |
| XLogP | 2.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|