C10H20N2 — CID 144734718
N,N-dimethylmethanamine;(3E,5Z)-hepta-1,3,5-trien-4-amine (PubChem CID 144734718) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N,N-dimethylmethanamine;(3E,5Z)-hepta-1,3,5-trien-4-amine.
| Compound Name | N,N-dimethylmethanamine;(3E,5Z)-hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 144734718 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N,N-dimethylmethanamine;(3E,5Z)-hepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(N)\C=C/C.CN(C)C |
| InChI | InChI=1S/C7H11N.C3H9N/c1-3-5-7(8)6-4-2;1-4(2)3/h3-6H,1,8H2,2H3;1-3H3/b6-4-,7-5+; |
| InChIKey | PMFKGYYPXMKZDO-ZMVRXXEHSA-N |
| XLogP | 1.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|