C12H18 — CID 21336128
(3E,5E,7E)-4,5,6-trimethylnona-1,3,5,7-tetraene (PubChem CID 21336128) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is (3E,5E,7E)-4,5,6-trimethylnona-1,3,5,7-tetraene.
| Compound Name | (3E,5E,7E)-4,5,6-trimethylnona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 21336128 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (3E,5E,7E)-4,5,6-trimethylnona-1,3,5,7-tetraene |
| SMILES | C=C/C=C(C)/C(C)=C(C)/C=C/C |
| InChI | InChI=1S/C12H18/c1-6-8-10(3)12(5)11(4)9-7-2/h6-9H,1H2,2-5H3/b9-7+,10-8+,12-11+ |
| InChIKey | NHPSNRHODBQGBG-KPZFFMOESA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|