C16H24 — CID 59890757
4,5,6,7,8-pentamethylundeca-1,3,5,7,9-pentaene (PubChem CID 59890757) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 4,5,6,7,8-pentamethylundeca-1,3,5,7,9-pentaene.
| Compound Name | 4,5,6,7,8-pentamethylundeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 59890757 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 4,5,6,7,8-pentamethylundeca-1,3,5,7,9-pentaene |
| SMILES | C=CC=C(C)C(C)=C(C)C(C)=C(C)C=CC |
| InChI | InChI=1S/C16H24/c1-8-10-12(3)14(5)16(7)15(6)13(4)11-9-2/h8-11H,1H2,2-7H3 |
| InChIKey | BCHIGPOZLVKSBI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|