C19H34 — CID 143865216
ethane;ethene;(3Z,5Z,7Z)-5-ethenyl-4,6-dimethylnona-1,3,5,7-tetraene (PubChem CID 143865216) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is ethane;ethene;(3Z,5Z,7Z)-5-ethenyl-4,6-dimethylnona-1,3,5,7-tetraene.
| Compound Name | ethane;ethene;(3Z,5Z,7Z)-5-ethenyl-4,6-dimethylnona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 143865216 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | ethane;ethene;(3Z,5Z,7Z)-5-ethenyl-4,6-dimethylnona-1,3,5,7-tetraene |
| SMILES | C=C.C=C/C=C(C)\C(C=C)=C(C)/C=C\C.CC.CC |
| InChI | InChI=1S/C13H18.2C2H6.C2H4/c1-6-9-11(4)13(8-3)12(5)10-7-2;3*1-2/h6-10H,1,3H2,2,4-5H3;2*1-2H3;1-2H2/b10-7-,11-9-,13-12-;;; |
| InChIKey | ZEMKEJDCSIKYHC-GQRAXARBSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|