C13H18 — CID 123254691
6-methyl-5-prop-1-en-2-ylnona-1,3,5,7-tetraene (PubChem CID 123254691) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 6-methyl-5-prop-1-en-2-ylnona-1,3,5,7-tetraene.
| Compound Name | 6-methyl-5-prop-1-en-2-ylnona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 123254691 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 6-methyl-5-prop-1-en-2-ylnona-1,3,5,7-tetraene |
| SMILES | C=CC=CC(C(=C)C)=C(C)C=CC |
| InChI | InChI=1S/C13H18/c1-6-8-10-13(11(3)4)12(5)9-7-2/h6-10H,1,3H2,2,4-5H3 |
| InChIKey | YZSUBFBRTJZYID-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|