C14H21F — CID 166995937
(2Z,4E)-7-fluoro-5,7-dimethyl-6-methylidene-4-prop-1-en-2-ylocta-2,4-diene (PubChem CID 166995937) has the molecular formula C14H21F and a molecular weight of 208.32 g/mol. Its IUPAC name is (2Z,4E)-7-fluoro-5,7-dimethyl-6-methylidene-4-prop-1-en-2-ylocta-2,4-diene.
| Compound Name | (2Z,4E)-7-fluoro-5,7-dimethyl-6-methylidene-4-prop-1-en-2-ylocta-2,4-diene |
|---|---|
| PubChem CID | 166995937 |
| Molecular Formula | C14H21F |
| Molecular Weight | 208.32 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (2Z,4E)-7-fluoro-5,7-dimethyl-6-methylidene-4-prop-1-en-2-ylocta-2,4-diene |
| SMILES | C=C(C)C(/C=C\C)=C(\C)C(=C)C(C)(C)F |
| InChI | InChI=1S/C14H21F/c1-8-9-13(10(2)3)11(4)12(5)14(6,7)15/h8-9H,2,5H2,1,3-4,6-7H3/b9-8-,13-11+ |
| InChIKey | KUSUXUGZVPYCNW-CWXHDNBGSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|