About (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene
(3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene (PubChem CID 142964222) has the molecular formula C9H14
and a molecular weight of 122.21 g/mol. Its IUPAC name is (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene.
Molecular Properties
| Compound Name | (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene |
| PubChem CID | 142964222 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene |
| SMILES | C=C(C)C(/C=C\C)=C\C |
| InChI | InChI=1S/C9H14/c1-5-7-9(6-2)8(3)4/h5-7H,3H2,1-2,4H3/b7-5-,9-6- |
| InChIKey | ARCSIMSYGGQCFH-BSIYMUDXSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene?
The IUPAC name of (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene (CID 142964222) is (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene.
What is the SMILES notation for (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene?
The canonical SMILES for (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene is C=C(C)C(/C=C\C)=C\C.
What is the InChIKey of (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene?
The InChIKey is ARCSIMSYGGQCFH-BSIYMUDXSA-N. The full InChI is InChI=1S/C9H14/c1-5-7-9(6-2)8(3)4/h5-7H,3H2,1-2,4H3/b7-5-,9-6-.
What are the key properties of (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene?
(3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene has a molecular weight of 122.21 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,4Z)-3-ethylidene-2-methylhexa-1,4-diene is sourced from PubChem (CID 142964222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).