C12H15F — CID 123639498
6-ethylidene-2-fluoro-5-methylidenenona-1,3,7-triene (PubChem CID 123639498) has the molecular formula C12H15F and a molecular weight of 178.25 g/mol. Its IUPAC name is 6-ethylidene-2-fluoro-5-methylidenenona-1,3,7-triene.
| Compound Name | 6-ethylidene-2-fluoro-5-methylidenenona-1,3,7-triene |
|---|---|
| PubChem CID | 123639498 |
| Molecular Formula | C12H15F |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 6-ethylidene-2-fluoro-5-methylidenenona-1,3,7-triene |
| SMILES | C=C(F)C=CC(=C)C(C=CC)=CC |
| InChI | InChI=1S/C12H15F/c1-5-7-12(6-2)10(3)8-9-11(4)13/h5-9H,3-4H2,1-2H3 |
| InChIKey | DMTVJHNFKKTKFL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|