C7H8F2 — CID 144675274
(4Z)-1,1-difluoro-3-methylidenehexa-1,4-diene (PubChem CID 144675274) has the molecular formula C7H8F2 and a molecular weight of 130.14 g/mol. Its IUPAC name is (4Z)-1,1-difluoro-3-methylidenehexa-1,4-diene.
| Compound Name | (4Z)-1,1-difluoro-3-methylidenehexa-1,4-diene |
|---|---|
| PubChem CID | 144675274 |
| Molecular Formula | C7H8F2 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (4Z)-1,1-difluoro-3-methylidenehexa-1,4-diene |
| SMILES | C=C(C=C(F)F)/C=C\C |
| InChI | InChI=1S/C7H8F2/c1-3-4-6(2)5-7(8)9/h3-5H,2H2,1H3/b4-3- |
| InChIKey | FVVRYEURKHRZQB-ARJAWSKDSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|