C7H8BrF — CID 142091470
(3E,5Z)-2-bromo-4-fluorohepta-1,3,5-triene (PubChem CID 142091470) has the molecular formula C7H8BrF and a molecular weight of 191.04 g/mol. Its IUPAC name is (3E,5Z)-2-bromo-4-fluorohepta-1,3,5-triene.
| Compound Name | (3E,5Z)-2-bromo-4-fluorohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142091470 |
| Molecular Formula | C7H8BrF |
| Molecular Weight | 191.04 g/mol |
| Exact Mass | 189.98 |
| IUPAC Name | (3E,5Z)-2-bromo-4-fluorohepta-1,3,5-triene |
| SMILES | C=C(Br)/C=C(F)\C=C/C |
| InChI | InChI=1S/C7H8BrF/c1-3-4-7(9)5-6(2)8/h3-5H,2H2,1H3/b4-3-,7-5+ |
| InChIKey | GTSRQVWLWKOREI-QVXLNCAUSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.04 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|