C12H20FNO2S — CID 163853555
2-[(3E,5Z)-4-fluoro-2-methylidenehepta-3,5-dienyl]sulfonyl-N,N-dimethylethanamine (PubChem CID 163853555) has the molecular formula C12H20FNO2S and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-[(3E,5Z)-4-fluoro-2-methylidenehepta-3,5-dienyl]sulfonyl-N,N-dimethylethanamine.
| Compound Name | 2-[(3E,5Z)-4-fluoro-2-methylidenehepta-3,5-dienyl]sulfonyl-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 163853555 |
| Molecular Formula | C12H20FNO2S |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-[(3E,5Z)-4-fluoro-2-methylidenehepta-3,5-dienyl]sulfonyl-N,N-dimethylethanamine |
| SMILES | C=C(/C=C(F)\C=C/C)CS(=O)(=O)CCN(C)C |
| InChI | InChI=1S/C12H20FNO2S/c1-5-6-12(13)9-11(2)10-17(15,16)8-7-14(3)4/h5-6,9H,2,7-8,10H2,1,3-4H3/b6-5-,12-9+ |
| InChIKey | OWKINDLFDKLFEH-ZCRLHDOISA-N |
| XLogP | 1.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|