C9H15NO2S — CID 134526328
(3Z,5Z)-N-methyl-2-methylidenehepta-3,5-diene-1-sulfonamide (PubChem CID 134526328) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-diene-1-sulfonamide.
| Compound Name | (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 134526328 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (3Z,5Z)-N-methyl-2-methylidenehepta-3,5-diene-1-sulfonamide |
| SMILES | C=C(/C=C\C=C/C)CS(=O)(=O)NC |
| InChI | InChI=1S/C9H15NO2S/c1-4-5-6-7-9(2)8-13(11,12)10-3/h4-7,10H,2,8H2,1,3H3/b5-4-,7-6- |
| InChIKey | PBGNRLDWVAOEBD-RZSVFLSASA-N |
| XLogP | 1.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|