C12H18O2S — CID 57050656
1-hexa-2,4-dienylsulfonylhexa-2,4-diene (PubChem CID 57050656) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 1-hexa-2,4-dienylsulfonylhexa-2,4-diene.
| Compound Name | 1-hexa-2,4-dienylsulfonylhexa-2,4-diene |
|---|---|
| PubChem CID | 57050656 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-hexa-2,4-dienylsulfonylhexa-2,4-diene |
| SMILES | CC=CC=CCS(=O)(=O)CC=CC=CC |
| InChI | InChI=1S/C12H18O2S/c1-3-5-7-9-11-15(13,14)12-10-8-6-4-2/h3-10H,11-12H2,1-2H3 |
| InChIKey | ARTLQCHVEJXHNQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|