C29H44O8S4 — CID 158466542
1-[3,3,3-tris(hexa-2,4-dienylsulfonyl)-2,2-dimethylpropyl]sulfonylhexa-2,4-diene (PubChem CID 158466542) has the molecular formula C29H44O8S4 and a molecular weight of 648.93 g/mol. Its IUPAC name is 1-[3,3,3-tris(hexa-2,4-dienylsulfonyl)-2,2-dimethylpropyl]sulfonylhexa-2,4-diene.
| Compound Name | 1-[3,3,3-tris(hexa-2,4-dienylsulfonyl)-2,2-dimethylpropyl]sulfonylhexa-2,4-diene |
|---|---|
| PubChem CID | 158466542 |
| Molecular Formula | C29H44O8S4 |
| Molecular Weight | 648.93 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | 1-[3,3,3-tris(hexa-2,4-dienylsulfonyl)-2,2-dimethylpropyl]sulfonylhexa-2,4-diene |
| SMILES | CC=CC=CCS(=O)(=O)CC(C)(C)C(S(=O)(=O)CC=CC=CC)(S(=O)(=O)CC=CC=CC)S(=O)(=O)CC=CC=CC |
| InChI | InChI=1S/C29H44O8S4/c1-7-11-15-19-23-38(30,31)27-28(5,6)29(39(32,33)24-20-16-12-8-2,40(34,35)25-21-17-13-9-3)41(36,37)26-22-18-14-10-4/h7-22H,23-27H2,1-6H3 |
| InChIKey | JCLVOTZCLFYGFG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.93 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|