About ethane;(2Z,4Z)-7-methylocta-2,4-diene
ethane;(2Z,4Z)-7-methylocta-2,4-diene (PubChem CID 143708090) has the molecular formula C11H22
and a molecular weight of 154.30 g/mol. Its IUPAC name is ethane;(2Z,4Z)-7-methylocta-2,4-diene.
Molecular Properties
| Compound Name | ethane;(2Z,4Z)-7-methylocta-2,4-diene |
| PubChem CID | 143708090 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | ethane;(2Z,4Z)-7-methylocta-2,4-diene |
| SMILES | C/C=C\C=C/CC(C)C.CC |
| InChI | InChI=1S/C9H16.C2H6/c1-4-5-6-7-8-9(2)3;1-2/h4-7,9H,8H2,1-3H3;1-2H3/b5-4-,7-6-; |
| InChIKey | ACRABXXTFNWSFZ-CYSANHHKSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2Z,4Z)-7-methylocta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2Z,4Z)-7-methylocta-2,4-diene?
The IUPAC name of ethane;(2Z,4Z)-7-methylocta-2,4-diene (CID 143708090) is ethane;(2Z,4Z)-7-methylocta-2,4-diene.
What is the SMILES notation for ethane;(2Z,4Z)-7-methylocta-2,4-diene?
The canonical SMILES for ethane;(2Z,4Z)-7-methylocta-2,4-diene is C/C=C\C=C/CC(C)C.CC.
What is the InChIKey of ethane;(2Z,4Z)-7-methylocta-2,4-diene?
The InChIKey is ACRABXXTFNWSFZ-CYSANHHKSA-N. The full InChI is InChI=1S/C9H16.C2H6/c1-4-5-6-7-8-9(2)3;1-2/h4-7,9H,8H2,1-3H3;1-2H3/b5-4-,7-6-;.
What are the key properties of ethane;(2Z,4Z)-7-methylocta-2,4-diene?
ethane;(2Z,4Z)-7-methylocta-2,4-diene has a molecular weight of 154.30 g/mol, XLogP of 4.19, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2Z,4Z)-7-methylocta-2,4-diene is sourced from PubChem (CID 143708090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).