About ethane;5-methylhex-2-ene;propane
ethane;5-methylhex-2-ene;propane (PubChem CID 143336274) has the molecular formula C16H40
and a molecular weight of 232.50 g/mol. Its IUPAC name is ethane;5-methylhex-2-ene;propane.
Molecular Properties
| Compound Name | ethane;5-methylhex-2-ene;propane |
| PubChem CID | 143336274 |
| Molecular Formula | C16H40 |
| Molecular Weight | 232.50 g/mol |
| Exact Mass | 232.31 |
| IUPAC Name | ethane;5-methylhex-2-ene;propane |
| SMILES | CC.CC.CC.CC=CCC(C)C.CCC |
| InChI | InChI=1S/C7H14.C3H8.3C2H6/c1-4-5-6-7(2)3;1-3-2;3*1-2/h4-5,7H,6H2,1-3H3;3H2,1-2H3;3*1-2H3 |
| InChIKey | SBJGBXMSZCTEAX-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.50 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-methylhex-2-ene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methylhex-2-ene;propane?
The IUPAC name of ethane;5-methylhex-2-ene;propane (CID 143336274) is ethane;5-methylhex-2-ene;propane.
What is the SMILES notation for ethane;5-methylhex-2-ene;propane?
The canonical SMILES for ethane;5-methylhex-2-ene;propane is CC.CC.CC.CC=CCC(C)C.CCC.
What is the InChIKey of ethane;5-methylhex-2-ene;propane?
The InChIKey is SBJGBXMSZCTEAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.C3H8.3C2H6/c1-4-5-6-7(2)3;1-3-2;3*1-2/h4-5,7H,6H2,1-3H3;3H2,1-2H3;3*1-2H3.
What are the key properties of ethane;5-methylhex-2-ene;propane?
ethane;5-methylhex-2-ene;propane has a molecular weight of 232.50 g/mol, XLogP of 7.10, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methylhex-2-ene;propane is sourced from PubChem (CID 143336274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).