About 5-bromohex-2-ene
5-bromohex-2-ene (PubChem CID 53438987) has the molecular formula C6H11Br
and a molecular weight of 163.06 g/mol. Its IUPAC name is 5-bromohex-2-ene.
Molecular Properties
| Compound Name | 5-bromohex-2-ene |
| PubChem CID | 53438987 |
| Molecular Formula | C6H11Br |
| Molecular Weight | 163.06 g/mol |
| Exact Mass | 162.00 |
| IUPAC Name | 5-bromohex-2-ene |
| SMILES | CC=CCC(C)Br |
| InChI | InChI=1S/C6H11Br/c1-3-4-5-6(2)7/h3-4,6H,5H2,1-2H3 |
| InChIKey | KIINZLUFNDBOOT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.06 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-bromohex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromohex-2-ene?
The IUPAC name of 5-bromohex-2-ene (CID 53438987) is 5-bromohex-2-ene.
What is the SMILES notation for 5-bromohex-2-ene?
The canonical SMILES for 5-bromohex-2-ene is CC=CCC(C)Br.
What is the InChIKey of 5-bromohex-2-ene?
The InChIKey is KIINZLUFNDBOOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11Br/c1-3-4-5-6(2)7/h3-4,6H,5H2,1-2H3.
What are the key properties of 5-bromohex-2-ene?
5-bromohex-2-ene has a molecular weight of 163.06 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromohex-2-ene is sourced from PubChem (CID 53438987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).