About 3-methylhept-5-en-1-yne
3-methylhept-5-en-1-yne (PubChem CID 123154929) has the molecular formula C8H12
and a molecular weight of 108.18 g/mol. Its IUPAC name is 3-methylhept-5-en-1-yne.
Molecular Properties
| Compound Name | 3-methylhept-5-en-1-yne |
| PubChem CID | 123154929 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | 3-methylhept-5-en-1-yne |
| SMILES | C#CC(C)CC=CC |
| InChI | InChI=1S/C8H12/c1-4-6-7-8(3)5-2/h2,4,6,8H,7H2,1,3H3 |
| InChIKey | QLDCVFKGMYXPNQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylhept-5-en-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhept-5-en-1-yne?
The IUPAC name of 3-methylhept-5-en-1-yne (CID 123154929) is 3-methylhept-5-en-1-yne.
What is the SMILES notation for 3-methylhept-5-en-1-yne?
The canonical SMILES for 3-methylhept-5-en-1-yne is C#CC(C)CC=CC.
What is the InChIKey of 3-methylhept-5-en-1-yne?
The InChIKey is QLDCVFKGMYXPNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12/c1-4-6-7-8(3)5-2/h2,4,6,8H,7H2,1,3H3.
What are the key properties of 3-methylhept-5-en-1-yne?
3-methylhept-5-en-1-yne has a molecular weight of 108.18 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhept-5-en-1-yne is sourced from PubChem (CID 123154929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).