C10H17N — CID 71353434
N-but-2-enyl-N,2-dimethylbut-3-yn-1-amine (PubChem CID 71353434) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N-but-2-enyl-N,2-dimethylbut-3-yn-1-amine.
| Compound Name | N-but-2-enyl-N,2-dimethylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 71353434 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-but-2-enyl-N,2-dimethylbut-3-yn-1-amine |
| SMILES | C#CC(C)CN(C)CC=CC |
| InChI | InChI=1S/C10H17N/c1-5-7-8-11(4)9-10(3)6-2/h2,5,7,10H,8-9H2,1,3-4H3 |
| InChIKey | HSEJUSYCSBLLMA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|