About ethane;(E)-5-methylhex-2-ene
ethane;(E)-5-methylhex-2-ene (PubChem CID 143114143) has the molecular formula C9H20
and a molecular weight of 128.26 g/mol. Its IUPAC name is ethane;(E)-5-methylhex-2-ene.
Molecular Properties
| Compound Name | ethane;(E)-5-methylhex-2-ene |
| PubChem CID | 143114143 |
| Molecular Formula | C9H20 |
| Molecular Weight | 128.26 g/mol |
| Exact Mass | 128.16 |
| IUPAC Name | ethane;(E)-5-methylhex-2-ene |
| SMILES | C/C=C/CC(C)C.CC |
| InChI | InChI=1S/C7H14.C2H6/c1-4-5-6-7(2)3;1-2/h4-5,7H,6H2,1-3H3;1-2H3/b5-4+; |
| InChIKey | XPWLBPWYERZXRZ-FXRZFVDSSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-5-methylhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-5-methylhex-2-ene?
The IUPAC name of ethane;(E)-5-methylhex-2-ene (CID 143114143) is ethane;(E)-5-methylhex-2-ene.
What is the SMILES notation for ethane;(E)-5-methylhex-2-ene?
The canonical SMILES for ethane;(E)-5-methylhex-2-ene is C/C=C/CC(C)C.CC.
What is the InChIKey of ethane;(E)-5-methylhex-2-ene?
The InChIKey is XPWLBPWYERZXRZ-FXRZFVDSSA-N. The full InChI is InChI=1S/C7H14.C2H6/c1-4-5-6-7(2)3;1-2/h4-5,7H,6H2,1-3H3;1-2H3/b5-4+;.
What are the key properties of ethane;(E)-5-methylhex-2-ene?
ethane;(E)-5-methylhex-2-ene has a molecular weight of 128.26 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-5-methylhex-2-ene is sourced from PubChem (CID 143114143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).