About (6E)-4-bromoocta-1,6-diene
(6E)-4-bromoocta-1,6-diene (PubChem CID 87341581) has the molecular formula C8H13Br
and a molecular weight of 189.10 g/mol. Its IUPAC name is (6E)-4-bromoocta-1,6-diene.
Molecular Properties
| Compound Name | (6E)-4-bromoocta-1,6-diene |
| PubChem CID | 87341581 |
| Molecular Formula | C8H13Br |
| Molecular Weight | 189.10 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | (6E)-4-bromoocta-1,6-diene |
| SMILES | C=CCC(Br)C/C=C/C |
| InChI | InChI=1S/C8H13Br/c1-3-5-7-8(9)6-4-2/h3-5,8H,2,6-7H2,1H3/b5-3+ |
| InChIKey | DNNZSCXAWQOVOV-HWKANZROSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.10 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-4-bromoocta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-4-bromoocta-1,6-diene?
The IUPAC name of (6E)-4-bromoocta-1,6-diene (CID 87341581) is (6E)-4-bromoocta-1,6-diene.
What is the SMILES notation for (6E)-4-bromoocta-1,6-diene?
The canonical SMILES for (6E)-4-bromoocta-1,6-diene is C=CCC(Br)C/C=C/C.
What is the InChIKey of (6E)-4-bromoocta-1,6-diene?
The InChIKey is DNNZSCXAWQOVOV-HWKANZROSA-N. The full InChI is InChI=1S/C8H13Br/c1-3-5-7-8(9)6-4-2/h3-5,8H,2,6-7H2,1H3/b5-3+.
What are the key properties of (6E)-4-bromoocta-1,6-diene?
(6E)-4-bromoocta-1,6-diene has a molecular weight of 189.10 g/mol, XLogP of 3.29, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-4-bromoocta-1,6-diene is sourced from PubChem (CID 87341581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).