C11H18O — CID 132557737
(4S,5E,8E)-6-methyldeca-1,5,8-trien-4-ol (PubChem CID 132557737) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (4S,5E,8E)-6-methyldeca-1,5,8-trien-4-ol.
| Compound Name | (4S,5E,8E)-6-methyldeca-1,5,8-trien-4-ol |
|---|---|
| PubChem CID | 132557737 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (4S,5E,8E)-6-methyldeca-1,5,8-trien-4-ol |
| SMILES | C=CC[C@H](O)/C=C(\C)C/C=C/C |
| InChI | InChI=1S/C11H18O/c1-4-6-8-10(3)9-11(12)7-5-2/h4-6,9,11-12H,2,7-8H2,1,3H3/b6-4+,10-9+/t11-/m0/s1 |
| InChIKey | HMNGXJDGNYDZPY-IXTCMTRWSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|