About hexa-1,5-dien-3-ol;hydrochloride
hexa-1,5-dien-3-ol;hydrochloride (PubChem CID 174661515) has the molecular formula C6H11ClO
and a molecular weight of 134.61 g/mol. Its IUPAC name is hexa-1,5-dien-3-ol;hydrochloride.
Molecular Properties
| Compound Name | hexa-1,5-dien-3-ol;hydrochloride |
| PubChem CID | 174661515 |
| Molecular Formula | C6H11ClO |
| Molecular Weight | 134.61 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | hexa-1,5-dien-3-ol;hydrochloride |
| SMILES | C=CCC(O)C=C.Cl |
| InChI | InChI=1S/C6H10O.ClH/c1-3-5-6(7)4-2;/h3-4,6-7H,1-2,5H2;1H |
| InChIKey | HYXHKFSKZVPVIA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.61 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hexa-1,5-dien-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-1,5-dien-3-ol;hydrochloride?
The IUPAC name of hexa-1,5-dien-3-ol;hydrochloride (CID 174661515) is hexa-1,5-dien-3-ol;hydrochloride.
What is the SMILES notation for hexa-1,5-dien-3-ol;hydrochloride?
The canonical SMILES for hexa-1,5-dien-3-ol;hydrochloride is C=CCC(O)C=C.Cl.
What is the InChIKey of hexa-1,5-dien-3-ol;hydrochloride?
The InChIKey is HYXHKFSKZVPVIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.ClH/c1-3-5-6(7)4-2;/h3-4,6-7H,1-2,5H2;1H.
What are the key properties of hexa-1,5-dien-3-ol;hydrochloride?
hexa-1,5-dien-3-ol;hydrochloride has a molecular weight of 134.61 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-1,5-dien-3-ol;hydrochloride is sourced from PubChem (CID 174661515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).