About 3-ethenylhex-5-ene-1,1-diol
3-ethenylhex-5-ene-1,1-diol (PubChem CID 144851586) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-ethenylhex-5-ene-1,1-diol.
Molecular Properties
| Compound Name | 3-ethenylhex-5-ene-1,1-diol |
| PubChem CID | 144851586 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 3-ethenylhex-5-ene-1,1-diol |
| SMILES | C=CCC(C=C)CC(O)O |
| InChI | InChI=1S/C8H14O2/c1-3-5-7(4-2)6-8(9)10/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | BTMURUXMIFCIOS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenylhex-5-ene-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylhex-5-ene-1,1-diol?
The IUPAC name of 3-ethenylhex-5-ene-1,1-diol (CID 144851586) is 3-ethenylhex-5-ene-1,1-diol.
What is the SMILES notation for 3-ethenylhex-5-ene-1,1-diol?
The canonical SMILES for 3-ethenylhex-5-ene-1,1-diol is C=CCC(C=C)CC(O)O.
What is the InChIKey of 3-ethenylhex-5-ene-1,1-diol?
The InChIKey is BTMURUXMIFCIOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-5-7(4-2)6-8(9)10/h3-4,7-10H,1-2,5-6H2.
What are the key properties of 3-ethenylhex-5-ene-1,1-diol?
3-ethenylhex-5-ene-1,1-diol has a molecular weight of 142.20 g/mol, XLogP of 1.07, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylhex-5-ene-1,1-diol is sourced from PubChem (CID 144851586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).