About azane;pent-4-en-2-ol
azane;pent-4-en-2-ol (PubChem CID 22149561) has the molecular formula C5H16N2O
and a molecular weight of 120.20 g/mol. Its IUPAC name is azane;pent-4-en-2-ol.
Molecular Properties
| Compound Name | azane;pent-4-en-2-ol |
| PubChem CID | 22149561 |
| Molecular Formula | C5H16N2O |
| Molecular Weight | 120.20 g/mol |
| Exact Mass | 120.13 |
| IUPAC Name | azane;pent-4-en-2-ol |
| SMILES | C=CCC(C)O.N.N |
| InChI | InChI=1S/C5H10O.2H3N/c1-3-4-5(2)6;;/h3,5-6H,1,4H2,2H3;2*1H3 |
| InChIKey | LVKMVHHNAWEJRP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;pent-4-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;pent-4-en-2-ol?
The IUPAC name of azane;pent-4-en-2-ol (CID 22149561) is azane;pent-4-en-2-ol.
What is the SMILES notation for azane;pent-4-en-2-ol?
The canonical SMILES for azane;pent-4-en-2-ol is C=CCC(C)O.N.N.
What is the InChIKey of azane;pent-4-en-2-ol?
The InChIKey is LVKMVHHNAWEJRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.2H3N/c1-3-4-5(2)6;;/h3,5-6H,1,4H2,2H3;2*1H3.
What are the key properties of azane;pent-4-en-2-ol?
azane;pent-4-en-2-ol has a molecular weight of 120.20 g/mol, XLogP of 1.27, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;pent-4-en-2-ol is sourced from PubChem (CID 22149561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).