C14H22O — CID 23092200
3-methyl-2-(3-methylhexa-1,5-dien-2-yloxy)hexa-1,5-diene (PubChem CID 23092200) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 3-methyl-2-(3-methylhexa-1,5-dien-2-yloxy)hexa-1,5-diene.
| Compound Name | 3-methyl-2-(3-methylhexa-1,5-dien-2-yloxy)hexa-1,5-diene |
|---|---|
| PubChem CID | 23092200 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 3-methyl-2-(3-methylhexa-1,5-dien-2-yloxy)hexa-1,5-diene |
| SMILES | C=CCC(C)C(=C)OC(=C)C(C)CC=C |
| InChI | InChI=1S/C14H22O/c1-7-9-11(3)13(5)15-14(6)12(4)10-8-2/h7-8,11-12H,1-2,5-6,9-10H2,3-4H3 |
| InChIKey | GXGVMDOSZKWEQK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|