C11H21N — CID 123847432
N,3-dimethyl-N-propan-2-ylhexa-1,5-dien-2-amine (PubChem CID 123847432) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is N,3-dimethyl-N-propan-2-ylhexa-1,5-dien-2-amine.
| Compound Name | N,3-dimethyl-N-propan-2-ylhexa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 123847432 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | N,3-dimethyl-N-propan-2-ylhexa-1,5-dien-2-amine |
| SMILES | C=CCC(C)C(=C)N(C)C(C)C |
| InChI | InChI=1S/C11H21N/c1-7-8-10(4)11(5)12(6)9(2)3/h7,9-10H,1,5,8H2,2-4,6H3 |
| InChIKey | BNCZZFUKWRQGMR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|