C10H22O — CID 160589694
methane;(2S,3R)-3-propan-2-ylhex-5-en-2-ol (PubChem CID 160589694) has the molecular formula C10H22O and a molecular weight of 158.28 g/mol. Its IUPAC name is methane;(2S,3R)-3-propan-2-ylhex-5-en-2-ol.
| Compound Name | methane;(2S,3R)-3-propan-2-ylhex-5-en-2-ol |
|---|---|
| PubChem CID | 160589694 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | methane;(2S,3R)-3-propan-2-ylhex-5-en-2-ol |
| SMILES | C.C=CC[C@H](C(C)C)[C@H](C)O |
| InChI | InChI=1S/C9H18O.CH4/c1-5-6-9(7(2)3)8(4)10;/h5,7-10H,1,6H2,2-4H3;1H4/t8-,9+;/m0./s1 |
| InChIKey | RCVPIWFHHCHNRH-OULXEKPRSA-N |
| XLogP | 2.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|