C11H22 — CID 59039366
(4S,5S)-5-methyl-4-propan-2-ylhept-1-ene (PubChem CID 59039366) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is (4S,5S)-5-methyl-4-propan-2-ylhept-1-ene.
| Compound Name | (4S,5S)-5-methyl-4-propan-2-ylhept-1-ene |
|---|---|
| PubChem CID | 59039366 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | (4S,5S)-5-methyl-4-propan-2-ylhept-1-ene |
| SMILES | C=CC[C@@H](C(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C11H22/c1-6-8-11(9(3)4)10(5)7-2/h6,9-11H,1,7-8H2,2-5H3/t10-,11-/m0/s1 |
| InChIKey | OIQNZXGVSQXARS-QWRGUYRKSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|