C12H20 — CID 23173905
2,6-dimethyl-4-prop-2-enylhepta-1,5-diene (PubChem CID 23173905) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene.
| Compound Name | 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene |
|---|---|
| PubChem CID | 23173905 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene |
| SMILES | C=CCC(C=C(C)C)CC(=C)C |
| InChI | InChI=1S/C12H20/c1-6-7-12(8-10(2)3)9-11(4)5/h6,9,12H,1-2,7-8H2,3-5H3 |
| InChIKey | XYWHIKJUHSHKGX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|