About 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene
2,6-dimethyl-4-prop-2-enylhepta-1,5-diene (PubChem CID 23173905) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene.
Molecular Properties
| Compound Name | 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene |
| PubChem CID | 23173905 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene |
| SMILES | C=CCC(C=C(C)C)CC(=C)C |
| InChI | InChI=1S/C12H20/c1-6-7-12(8-10(2)3)9-11(4)5/h6,9,12H,1-2,7-8H2,3-5H3 |
| InChIKey | XYWHIKJUHSHKGX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene?
The IUPAC name of 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene (CID 23173905) is 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene.
What is the SMILES notation for 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene?
The canonical SMILES for 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene is C=CCC(C=C(C)C)CC(=C)C.
What is the InChIKey of 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene?
The InChIKey is XYWHIKJUHSHKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20/c1-6-7-12(8-10(2)3)9-11(4)5/h6,9,12H,1-2,7-8H2,3-5H3.
What are the key properties of 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene?
2,6-dimethyl-4-prop-2-enylhepta-1,5-diene has a molecular weight of 164.29 g/mol, XLogP of 4.11, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-prop-2-enylhepta-1,5-diene is sourced from PubChem (CID 23173905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).