C12H18 — CID 162498864
2-methyl-3-methylidene-4-prop-2-enylhepta-1,6-diene (PubChem CID 162498864) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 2-methyl-3-methylidene-4-prop-2-enylhepta-1,6-diene.
| Compound Name | 2-methyl-3-methylidene-4-prop-2-enylhepta-1,6-diene |
|---|---|
| PubChem CID | 162498864 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 2-methyl-3-methylidene-4-prop-2-enylhepta-1,6-diene |
| SMILES | C=CCC(CC=C)C(=C)C(=C)C |
| InChI | InChI=1S/C12H18/c1-6-8-12(9-7-2)11(5)10(3)4/h6-7,12H,1-3,5,8-9H2,4H3 |
| InChIKey | SKANIWNJFNSACD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|