C11H20 — CID 59911407
(4R,5Z)-5-methyl-4-propan-2-ylhepta-1,5-diene (PubChem CID 59911407) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (4R,5Z)-5-methyl-4-propan-2-ylhepta-1,5-diene.
| Compound Name | (4R,5Z)-5-methyl-4-propan-2-ylhepta-1,5-diene |
|---|---|
| PubChem CID | 59911407 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (4R,5Z)-5-methyl-4-propan-2-ylhepta-1,5-diene |
| SMILES | C=CC[C@@H](/C(C)=C\C)C(C)C |
| InChI | InChI=1S/C11H20/c1-6-8-11(9(3)4)10(5)7-2/h6-7,9,11H,1,8H2,2-5H3/b10-7-/t11-/m1/s1 |
| InChIKey | GCHZLYIAOHEDBG-ZJRUKIMVSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|