C22H36 — CID 140594180
(7E)-4,7,10-trimethyl-5-(3-methylbut-2-enyl)-6-prop-2-enylundeca-1,7,9-triene (PubChem CID 140594180) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is (7E)-4,7,10-trimethyl-5-(3-methylbut-2-enyl)-6-prop-2-enylundeca-1,7,9-triene.
| Compound Name | (7E)-4,7,10-trimethyl-5-(3-methylbut-2-enyl)-6-prop-2-enylundeca-1,7,9-triene |
|---|---|
| PubChem CID | 140594180 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | (7E)-4,7,10-trimethyl-5-(3-methylbut-2-enyl)-6-prop-2-enylundeca-1,7,9-triene |
| SMILES | C=CCC(C)C(CC=C(C)C)C(CC=C)/C(C)=C/C=C(C)C |
| InChI | InChI=1S/C22H36/c1-9-11-19(7)22(16-14-18(5)6)21(12-10-2)20(8)15-13-17(3)4/h9-10,13-15,19,21-22H,1-2,11-12,16H2,3-8H3/b20-15+ |
| InChIKey | LXAURZGJZWDSPH-HMMYKYKNSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|