C18H36 — CID 143234765
(5E)-5,8-dimethyl-4-[(Z)-prop-1-enyl]nona-1,5,7-triene;ethane;methane (PubChem CID 143234765) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is (5E)-5,8-dimethyl-4-[(Z)-prop-1-enyl]nona-1,5,7-triene;ethane;methane.
| Compound Name | (5E)-5,8-dimethyl-4-[(Z)-prop-1-enyl]nona-1,5,7-triene;ethane;methane |
|---|---|
| PubChem CID | 143234765 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | (5E)-5,8-dimethyl-4-[(Z)-prop-1-enyl]nona-1,5,7-triene;ethane;methane |
| SMILES | C.C.C=CCC(/C=C\C)/C(C)=C/C=C(C)C.CC |
| InChI | InChI=1S/C14H22.C2H6.2CH4/c1-6-8-14(9-7-2)13(5)11-10-12(3)4;1-2;;/h6-7,9-11,14H,1,8H2,2-5H3;1-2H3;2*1H4/b9-7-,13-11+;;; |
| InChIKey | OYIHCKBSRFPXKD-ABBJJJLBSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|