C9H15NS — CID 88578836
(1Z,4Z)-2-amino-3-prop-2-enylhexa-1,4-diene-1-thiol (PubChem CID 88578836) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is (1Z,4Z)-2-amino-3-prop-2-enylhexa-1,4-diene-1-thiol.
| Compound Name | (1Z,4Z)-2-amino-3-prop-2-enylhexa-1,4-diene-1-thiol |
|---|---|
| PubChem CID | 88578836 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (1Z,4Z)-2-amino-3-prop-2-enylhexa-1,4-diene-1-thiol |
| SMILES | C=CCC(/C=C\C)/C(N)=C/S |
| InChI | InChI=1S/C9H15NS/c1-3-5-8(6-4-2)9(10)7-11/h3-4,6-8,11H,1,5,10H2,2H3/b6-4-,9-7- |
| InChIKey | XENXIUFFJYBRSD-PJPBHMPJSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|