C11H18N2O — CID 89429032
(3E)-4-(aminomethyl)-2-prop-2-enylhepta-3,6-dienamide (PubChem CID 89429032) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (3E)-4-(aminomethyl)-2-prop-2-enylhepta-3,6-dienamide.
| Compound Name | (3E)-4-(aminomethyl)-2-prop-2-enylhepta-3,6-dienamide |
|---|---|
| PubChem CID | 89429032 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (3E)-4-(aminomethyl)-2-prop-2-enylhepta-3,6-dienamide |
| SMILES | C=CC/C(=C\C(CC=C)C(N)=O)CN |
| InChI | InChI=1S/C11H18N2O/c1-3-5-9(8-12)7-10(6-4-2)11(13)14/h3-4,7,10H,1-2,5-6,8,12H2,(H2,13,14)/b9-7+ |
| InChIKey | PLYUNSHBXFZILX-VQHVLOKHSA-N |
| XLogP | 1.13 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|