C12H20N2O2 — CID 121007809
2,5-bis(prop-2-enyl)hexanediamide (PubChem CID 121007809) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2,5-bis(prop-2-enyl)hexanediamide.
| Compound Name | 2,5-bis(prop-2-enyl)hexanediamide |
|---|---|
| PubChem CID | 121007809 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2,5-bis(prop-2-enyl)hexanediamide |
| SMILES | C=CCC(CCC(CC=C)C(N)=O)C(N)=O |
| InChI | InChI=1S/C12H20N2O2/c1-3-5-9(11(13)15)7-8-10(6-4-2)12(14)16/h3-4,9-10H,1-2,5-8H2,(H2,13,15)(H2,14,16) |
| InChIKey | CSJDHRKTODNATD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|